EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N4O3 |
| Net Charge | 0 |
| Average Mass | 224.220 |
| Monoisotopic Mass | 224.09094 |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C9H12N4O3/c1-10-5-6(11(2)8(10)15)12(3)9(16)13(4)7(5)14/h1-4H3 |
| InChIKey | QGDOQULISIQFHQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis var. kucha (ncbitaxon:2712854) | - | PubMed (32730889) | |
| Coffea dewevrei (ncbitaxon:213301) | - | PubMed (16720319) | |
| Coffea liberica (ncbitaxon:49373) | - | PubMed (16720319) | |
| Theobroma grandiflorum (ncbitaxon:108881) | - | PubMed (18068204) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) has functional parent 7,9-dihydro-1H-purine-2,6,8(3H)-trione (CHEBI:17775) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) has role analgesic (CHEBI:35480) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) has role anti-inflammatory agent (CHEBI:67079) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) has role human xenobiotic metabolite (CHEBI:76967) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) has role plant metabolite (CHEBI:76924) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) is a oxopurine (CHEBI:25810) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) is a purine alkaloid (CHEBI:26385) |
| IUPAC Name |
|---|
| 1,3,7,9-tetramethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione |
| Synonyms | Source |
|---|---|
| 1,3,7,9-tetramethyluric acid | ChemIDplus |
| Ba 2750 | ChemIDplus |
| temorine | ChemIDplus |
| temurin | ChemIDplus |
| tetramethyl-2,3,6,7,8,9-hexahydro-1H-purine-2,6,8-trione | IUPAC |
| tetramethyl uric acid | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| TeaCrine | ChEBI |
| UniProt Name | Source |
|---|---|
| theacrine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 67862 | ChemSpider |
| C00034312 | KNApSAcK |
| CN101289448 | Patent |
| CPD-12505 | MetaCyc |
| FDB015351 | FooDB |
| HMDB0004328 | HMDB |
| Theacrine | Wikipedia |
| Citations |
|---|