EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N4O3 |
| Net Charge | 0 |
| Average Mass | 224.220 |
| Monoisotopic Mass | 224.09094 |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C9H12N4O3/c1-10-5-6(11(2)8(10)15)12(3)9(16)13(4)7(5)14/h1-4H3 |
| InChIKey | QGDOQULISIQFHQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis var. kucha (ncbitaxon:2712854) | - | PubMed (32730889) | |
| Coffea dewevrei (ncbitaxon:213301) | - | PubMed (16720319) | |
| Coffea liberica (ncbitaxon:49373) | - | PubMed (16720319) | |
| Theobroma grandiflorum (ncbitaxon:108881) | - | PubMed (18068204) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) has functional parent 7,9-dihydro-1H-purine-2,6,8(3H)-trione (CHEBI:17775) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) has role analgesic (CHEBI:35480) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) has role anti-inflammatory agent (CHEBI:67079) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) has role human xenobiotic metabolite (CHEBI:76967) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) has role plant metabolite (CHEBI:76924) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) is a oxopurine (CHEBI:25810) |
| 1,3,7,9-tetramethyluric acid (CHEBI:139388) is a purine alkaloid (CHEBI:26385) |
| IUPAC Name |
|---|
| 1,3,7,9-tetramethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione |
| Synonyms | Source |
|---|---|
| 1,3,7,9-tetramethyluric acid | ChemIDplus |
| Ba 2750 | ChemIDplus |
| temorine | ChemIDplus |
| temurin | ChemIDplus |
| tetramethyl-2,3,6,7,8,9-hexahydro-1H-purine-2,6,8-trione | IUPAC |
| tetramethyl uric acid | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| TeaCrine | ChEBI |
| UniProt Name | Source |
|---|---|
| theacrine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 67862 | ChemSpider |
| C00034312 | KNApSAcK |
| CN101289448 | Patent |
| CPD-12505 | MetaCyc |
| FDB015351 | FooDB |
| HMDB0004328 | HMDB |
| Theacrine | Wikipedia |
| Citations |
|---|