EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:139384 - 2-hydroxy-2-(2-methylidenecyclopropyl)butanedioic acid
| Formula | C8H10O5 |
| Net Charge | 0 |
| Average Mass | 186.163 |
| Monoisotopic Mass | 186.05282 |
| SMILES | C=C1CC1C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10O5/c1-4-2-5(4)8(13,7(11)12)3-6(9)10/h5,13H,1-3H2,(H,9,10)(H,11,12) |
| InChIKey | HVURSLAWIDCRKB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-2-(2-methylidenecyclopropyl)butanedioic acid (CHEBI:139384) is a carbocyclic fatty acid (CHEBI:35744) |