EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8[13C]H11NO2 |
| Net Charge | 0 |
| Average Mass | 166.184 |
| Monoisotopic Mass | 166.08233 |
| SMILES | CC(=O)Nc1ccc(O[13CH3])cc1 |
| InChI | InChI=1S/C9H11NO2/c1-7(11)10-8-3-5-9(12-2)6-4-8/h3-6H,1-2H3,(H,10,11)/i2+1 |
| InChIKey | XVAIDCNLVLTVFM-VQEHIDDOSA-N |
| Roles Classification |
|---|
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. isotopic tracer A tracer which only differs in isotopic composition from the substance to be traced. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methacetin-(methoxy-13C) (CHEBI:139355) has role diagnostic agent (CHEBI:33295) |
| methacetin-(methoxy-13C) (CHEBI:139355) has role isotopic tracer (CHEBI:35206) |
| methacetin-(methoxy-13C) (CHEBI:139355) is a 13C-modified compound (CHEBI:139357) |
| methacetin-(methoxy-13C) (CHEBI:139355) is a acetamides (CHEBI:22160) |
| methacetin-(methoxy-13C) (CHEBI:139355) is a aromatic ether (CHEBI:35618) |
| IUPAC Name |
|---|
| N-{4-[(13C)methyloxy]phenyl}acetamide |
| Synonyms | Source |
|---|---|
| p-acetanisidine C-13 | ChemIDplus |
| methacetin C-13 | ChemIDplus |
| methacetin methoxy-C-13 | ChemIDplus |
| 13C-methacetin | ChEBI |
| (13)C-MBT | ChEBI |
| [13C]methacetin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:31580327 | Reaxys |
| CAS:72156-70-8 | ChemIDplus |
| Citations |
|---|