EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44NO19 |
| Net Charge | 0 |
| Average Mass | 674.626 |
| Monoisotopic Mass | 674.25075 |
| SMILES | *[C@H]1O[C@H](CO)[C@H](O)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[C@@H]3O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]3O)[C@H](O)[C@H]2NC(C)=O)[C@H]1O |
| Roles Classification |
|---|
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-Fuc-(1→2)-β-D-Gal-(1→4)-β-D-GlcNAc-(1→3)-α-D-Gal-yl group (CHEBI:139351) has role antigen (CHEBI:59132) |
| α-L-Fuc-(1→2)-β-D-Gal-(1→4)-β-D-GlcNAc-(1→3)-α-D-Gal-yl group (CHEBI:139351) is a α-D-galactosyl group (CHEBI:61248) |