EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23NO3 |
| Net Charge | 0 |
| Average Mass | 337.419 |
| Monoisotopic Mass | 337.16779 |
| SMILES | CCCCCc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-2-3-4-7-16-10-12-17(13-11-16)14-15-20(23)22-19-9-6-5-8-18(19)21(24)25/h5-6,8-15H,2-4,7H2,1H3,(H,22,23)(H,24,25)/b15-14+ |
| InChIKey | GAMRBCZMOOMBSQ-CCEZHUSRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | TRP channel blocker An agent that inhibits the passage of cations through the transient receptor potential (TRP) channels. EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(p-amylcinnamoyl)anthranilic acid (CHEBI:139349) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| N-(p-amylcinnamoyl)anthranilic acid (CHEBI:139349) has role TRP channel blocker (CHEBI:139361) |
| N-(p-amylcinnamoyl)anthranilic acid (CHEBI:139349) is a amidobenzoic acid (CHEBI:48470) |
| N-(p-amylcinnamoyl)anthranilic acid (CHEBI:139349) is a cinnamamides (CHEBI:23247) |
| N-(p-amylcinnamoyl)anthranilic acid (CHEBI:139349) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-{[(2E)-3-(4-pentylphenyl)prop-2-enoyl]amino}benzoic acid |
| Synonyms | Source |
|---|---|
| ACA | SUBMITTER |
| 4-amylcinnamoylanthranilic acid | ChemIDplus |
| p-amylcinnamoylanthranilic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 329770958 | PubChem Compound |
| N-(p-amylcinnamoyl)anthranilic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6521595 | Reaxys |
| CAS:110683-10-8 | ChemIDplus |
| Citations |
|---|