EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23NO3 |
| Net Charge | 0 |
| Average Mass | 337.419 |
| Monoisotopic Mass | 337.16779 |
| SMILES | CCCCCc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-2-3-4-7-16-10-12-17(13-11-16)14-15-20(23)22-19-9-6-5-8-18(19)21(24)25/h5-6,8-15H,2-4,7H2,1H3,(H,22,23)(H,24,25)/b15-14+ |
| InChIKey | GAMRBCZMOOMBSQ-CCEZHUSRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.1.1.4 (phospholipase A2) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of phospholipase A2 (EC 3.1.1.4). TRP channel blocker An agent that inhibits the passage of cations through the transient receptor potential (TRP) channels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(p-amylcinnamoyl)anthranilic acid (CHEBI:139349) has role EC 3.1.1.4 (phospholipase A2) inhibitor (CHEBI:50469) |
| N-(p-amylcinnamoyl)anthranilic acid (CHEBI:139349) has role TRP channel blocker (CHEBI:139361) |
| N-(p-amylcinnamoyl)anthranilic acid (CHEBI:139349) is a amidobenzoic acid (CHEBI:48470) |
| N-(p-amylcinnamoyl)anthranilic acid (CHEBI:139349) is a cinnamamides (CHEBI:23247) |
| N-(p-amylcinnamoyl)anthranilic acid (CHEBI:139349) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-{[(2E)-3-(4-pentylphenyl)prop-2-enoyl]amino}benzoic acid |
| Synonyms | Source |
|---|---|
| 4-amylcinnamoylanthranilic acid | ChemIDplus |
| ACA | SUBMITTER |
| p-amylcinnamoylanthranilic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 329770958 | PubChem Compound |
| N-(p-amylcinnamoyl)anthranilic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6521595 | Reaxys |
| CAS:110683-10-8 | ChemIDplus |
| Citations |
|---|