EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | [H]C(=O)CC/C(C)=C\CC/C(C)=C\CCC(C)=O |
| InChI | InChI=1S/C15H24O2/c1-13(9-5-11-15(3)17)7-4-8-14(2)10-6-12-16/h8-9,12H,4-7,10-11H2,1-3H3/b13-9-,14-8- |
| InChIKey | WFSIQNRAWDRWLN-RDBXOABQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xanthomonas sp. (ncbitaxon:29446) | - | PubMed (18259065) | Strain: 35Y |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4Z,8Z)-4,8-dimethyl-12-oxotrideca-4,8-dienal (CHEBI:139337) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| (4Z,8Z)-4,8-dimethyl-12-oxotrideca-4,8-dienal (CHEBI:139337) is a aliphatic aldehyde (CHEBI:59768) |
| (4Z,8Z)-4,8-dimethyl-12-oxotrideca-4,8-dienal (CHEBI:139337) is a methyl ketone (CHEBI:51867) |
| (4Z,8Z)-4,8-dimethyl-12-oxotrideca-4,8-dienal (CHEBI:139337) is a olefinic compound (CHEBI:78840) |
| (4Z,8Z)-4,8-dimethyl-12-oxotrideca-4,8-dienal (CHEBI:139337) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (4Z,8Z)-4,8-dimethyl-12-oxotrideca-4,8-dienal |
| Synonym | Source |
|---|---|
| ODTD | MetaCyc |
| UniProt Name | Source |
|---|---|
| (4Z,8Z)-4,8-dimethyl-12-oxotrideca-4,8-dienal | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20487 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5259121 | Reaxys |
| Citations |
|---|