EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 273.119 |
| Monoisotopic Mass | 272.01193 |
| SMILES | [NH3+][C@@H](Cc1cnc2c(Cl)c(Cl)ccc12)C(=O)[O-] |
| InChI | InChI=1S/C11H10Cl2N2O2/c12-7-2-1-6-5(3-8(14)11(16)17)4-15-10(6)9(7)13/h1-2,4,8,15H,3,14H2,(H,16,17)/t8-/m0/s1 |
| InChIKey | FWPPTMJFWIEUPY-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,7-dichloro-L-tryptophan zwitterion (CHEBI:139336) is a L-α-amino acid zwitterion (CHEBI:59869) |
| 6,7-dichloro-L-tryptophan zwitterion (CHEBI:139336) is tautomer of 6,7-dichloro-L-tryptophan (CHEBI:140086) |
| Incoming Relation(s) |
| 6,7-dichloro-L-tryptophan (CHEBI:140086) is tautomer of 6,7-dichloro-L-tryptophan zwitterion (CHEBI:139336) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-(6,7-dichloro-1H-indol-3-yl)propanoate |
| Synonym | Source |
|---|---|
| 6,7-dichlorotryptophan zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| 6,7-dichloro-L-tryptophan | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20614 | MetaCyc |