EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15F2N3S |
| Net Charge | 0 |
| Average Mass | 295.358 |
| Monoisotopic Mass | 295.09547 |
| SMILES | NCc1cnc(=S)n1[C@H]1CCc2c(F)cc(F)cc2C1 |
| InChI | InChI=1S/C14H15F2N3S/c15-9-3-8-4-10(1-2-12(8)13(16)5-9)19-11(6-17)7-18-14(19)20/h3,5,7,10H,1-2,4,6,17H2,(H,18,20)/t10-/m0/s1 |
| InChIKey | YZZVIKDAOTXDEB-JTQLQIEISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 1.14.17.1 (dopamine beta-monooxygenase) inhibitor An EC 1.14.17.* (oxidoreductase acting on paired donors, with incorporation or reduction of molecular oxygen and with reduced ascorbate as one donor, and incorporation of one atom of oxygen) inhibitor that interferes with the action of dopamine monooxygenase (EC 1.14.17.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nepicastat (CHEBI:139334) has role EC 1.14.17.1 (dopamine β-monooxygenase) inhibitor (CHEBI:139339) |
| nepicastat (CHEBI:139334) is a 1,3-dihydroimidazole-2-thiones (CHEBI:139340) |
| nepicastat (CHEBI:139334) is a organofluorine compound (CHEBI:37143) |
| nepicastat (CHEBI:139334) is a primary amino compound (CHEBI:50994) |
| nepicastat (CHEBI:139334) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| 5-(aminomethyl)-1-[(2S)-5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-1,3-dihydro-2H-imidazole-2-thione |
| INNs | Source |
|---|---|
| nepicastatum | WHO MedNet |
| nepicastat | WHO MedNet |
| népicastat | WHO MedNet |
| nepicastat | WHO MedNet |
| Synonyms | Source |
|---|---|
| RS-25560-197 | ChEBI |
| SYN117 | ChEBI |
| (S)-5-aminomethyl-1-(5,7-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl)-1,3-dihydroimidazole-2-thione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 9796181 | PubChem Compound |
| DB12979 | DrugBank |
| Nepicastat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9425404 | Reaxys |
| CAS:173997-05-2 | ChemIDplus |
| Citations |
|---|