EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44N7O18P3S |
| Net Charge | 0 |
| Average Mass | 867.658 |
| Monoisotopic Mass | 867.16764 |
| SMILES | CC[C@H](O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C26H44N7O18P3S/c1-4-14(34)9-17(36)55-8-7-28-16(35)5-6-29-24(39)21(38)26(2,3)11-48-54(45,46)51-53(43,44)47-10-15-20(50-52(40,41)42)19(37)25(49-15)33-13-32-18-22(27)30-12-31-23(18)33/h12-15,19-21,25,34,37-38H,4-11H2,1-3H3,(H,28,35)(H,29,39)(H,43,44)(H,45,46)(H2,27,30,31)(H2,40,41,42)/t14-,15+,19+,20+,21-,25+/m0/s1 |
| InChIKey | YYGYPCRWZMLSGK-VDGSKMPFSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-hydroxypentanoyl-CoA (CHEBI:139268) has functional parent (S)-3-hydroxypentanoic acid (CHEBI:139270) |
| (S)-3-hydroxypentanoyl-CoA (CHEBI:139268) is a 3-hydroxy fatty acyl-CoA (CHEBI:20060) |
| (S)-3-hydroxypentanoyl-CoA (CHEBI:139268) is a 3-hydroxypentanoyl-CoA(4-) (CHEBI:231432) |
| (S)-3-hydroxypentanoyl-CoA (CHEBI:139268) is a short-chain fatty acyl-CoA (CHEBI:61905) |
| (S)-3-hydroxypentanoyl-CoA (CHEBI:139268) is conjugate acid of (S)-3-hydroxypentanoyl-CoA(4−) (CHEBI:138607) |
| Incoming Relation(s) |
| (S)-3-hydroxypentanoyl-CoA(4−) (CHEBI:138607) is conjugate base of (S)-3-hydroxypentanoyl-CoA (CHEBI:139268) |
| IUPAC Names |
|---|
| S-[(3S)-3-hydroxypentanoyl]-coenzyme A |
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-4-({3-[(2-{[(3S)-3-hydroxypentanoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| (S)-3-hydroxyvaleryl-coenzyme A | ChEBI |
| (S)-3-hydroxypentanoyl-coenzyme A | ChEBI |
| (3S)-hydroxyvaleryl-coenzyme A | ChEBI |
| (3S)-hydroxyvaleryl-CoA | ChEBI |
| (3S)-hydroxypentanoyl-CoA | ChEBI |
| (S)-3-hydroxyvaleryl-CoA | ChEBI |