EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:139267 - [(3S)-4-(6-methylheptanoyl)-5-oxooxolan-3-yl]methyl phosphate
| Formula | C13H23O7P |
| Net Charge | 0 |
| Average Mass | 322.294 |
| Monoisotopic Mass | 322.11814 |
| SMILES | CC(C)CCCCC(=O)C1C(=O)OC[C@H]1COP(=O)(O)O |
| InChI | InChI=1S/C13H23O7P/c1-9(2)5-3-4-6-11(14)12-10(7-19-13(12)15)8-20-21(16,17)18/h9-10,12H,3-8H2,1-2H3,(H2,16,17,18)/t10-,12?/m0/s1 |
| InChIKey | SVSJADIUUOOBST-NUHJPDEHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseus (ncbitaxon:1911) | - | PubMed (17277085) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(3S)-4-(6-methylheptanoyl)-5-oxooxolan-3-yl]methyl phosphate (CHEBI:139267) has role bacterial metabolite (CHEBI:76969) |
| [(3S)-4-(6-methylheptanoyl)-5-oxooxolan-3-yl]methyl phosphate (CHEBI:139267) is a butan-4-olide (CHEBI:22950) |
| [(3S)-4-(6-methylheptanoyl)-5-oxooxolan-3-yl]methyl phosphate (CHEBI:139267) is a monoalkyl phosphate (CHEBI:25381) |
| [(3S)-4-(6-methylheptanoyl)-5-oxooxolan-3-yl]methyl phosphate (CHEBI:139267) is a β-ketoester (CHEBI:51849) |
| [(3S)-4-(6-methylheptanoyl)-5-oxooxolan-3-yl]methyl phosphate (CHEBI:139267) is conjugate acid of [(3S,4R)-4-(6-methylheptanoyl)-5-oxooxolan-3-yl]methyl phosphate(2−) (CHEBI:138605) |
| Incoming Relation(s) |
| [(3S,4R)-4-(6-methylheptanoyl)-5-oxooxolan-3-yl]methyl phosphate(2−) (CHEBI:138605) is conjugate base of [(3S)-4-(6-methylheptanoyl)-5-oxooxolan-3-yl]methyl phosphate (CHEBI:139267) |
| IUPAC Name |
|---|
| [(3S)-4-(6-methylheptanoyl)-5-oxooxolan-3-yl]methyl dihydrogen phosphate |
| Manual Xrefs | Databases |
|---|---|
| CPD-19888 | MetaCyc |
| Citations |
|---|