EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N6O8 |
| Net Charge | 0 |
| Average Mass | 440.413 |
| Monoisotopic Mass | 440.16556 |
| SMILES | NCCCC[C@H](NC(=O)CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)NCCC(=O)O |
| InChI | InChI=1S/C17H24N6O8/c18-7-2-1-3-13(17(27)19-8-6-16(25)26)21-15(24)10-20-12-5-4-11(22(28)29)9-14(12)23(30)31/h4-5,9,13,20H,1-3,6-8,10,18H2,(H,19,27)(H,21,24)(H,25,26)/t13-/m0/s1 |
| InChIKey | AIEWLTYUBGRBLD-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | peptide probe A probe that is a small labelled and chemical active peptide which has been structurally modified for reacting with, for example, the β-lactam moieties of various penicillin-type compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DNP-N-GKβA-OH (CHEBI:139251) has role peptide probe (CHEBI:139246) |
| DNP-N-GKβA-OH (CHEBI:139251) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| N-(2,4-dinitrophenyl)glycyl-L-lysyl-β-alanine |
| Synonym | Source |
|---|---|
| N-(2,4-dinitrophenyl)Gly-Lys-βAla-OH | ChEBI |
| Citations |
|---|