EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N5O8 |
| Net Charge | 0 |
| Average Mass | 381.301 |
| Monoisotopic Mass | 381.09206 |
| SMILES | CN(c1ccc([N+](=O)[O-])c2nonc12)[C@@H](CC(=O)O)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C14H15N5O8/c1-18(9(6-11(22)23)14(24)15-5-4-10(20)21)7-2-3-8(19(25)26)13-12(7)16-27-17-13/h2-3,9H,4-6H2,1H3,(H,15,24)(H,20,21)(H,22,23)/t9-/m0/s1 |
| InChIKey | ZVCZBCQZSKITFI-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | peptide probe A probe that is a small labelled and chemical active peptide which has been structurally modified for reacting with, for example, the β-lactam moieties of various penicillin-type compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NBD-N(Me)-DβA-OH (CHEBI:139250) has role peptide probe (CHEBI:139246) |
| NBD-N(Me)-DβA-OH (CHEBI:139250) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| N-methyl-N-(7-nitro-2,1,3-benzoxadiazol-4-yl)-L-α-aspartyl-β-alanine |
| Synonym | Source |
|---|---|
| N-methyl-N-(7-nitro-2,1,3-benzoxadiazol-4-yl)-Asp-βAla-OH | ChEBI |
| Citations |
|---|