EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H53N11O12S |
| Net Charge | 0 |
| Average Mass | 863.952 |
| Monoisotopic Mass | 863.35959 |
| SMILES | CN(c1ccc([N+](=O)[O-])c2nonc12)[C@@H](CC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCNC(=O)CCCCC1SCC2NC(=O)NC21)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C36H53N11O12S/c1-46(23-12-13-24(47(57)58)32-31(23)44-59-45-32)25(18-29(51)52)35(55)41-21(8-4-6-15-37)34(54)40-20(33(53)39-17-14-28(49)50)9-5-7-16-38-27(48)11-3-2-10-26-30-22(19-60-26)42-36(56)43-30/h12-13,20-22,25-26,30H,2-11,14-19,37H2,1H3,(H,38,48)(H,39,53)(H,40,54)(H,41,55)(H,49,50)(H,51,52)(H2,42,43,56)/t20-,21-,22?,25-,26?,30?/m0/s1 |
| InChIKey | IUOZKUSPWNZWPN-PIAVXVASSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | peptide allergen Any peptide which causes the onset of an allergic reaction. |
| Application: | peptide probe A probe that is a small labelled and chemical active peptide which has been structurally modified for reacting with, for example, the β-lactam moieties of various penicillin-type compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NBD-N(Me)-DKK(Biotin)βA-OH (CHEBI:139247) has role peptide allergen (CHEBI:143204) |
| NBD-N(Me)-DKK(Biotin)βA-OH (CHEBI:139247) has role peptide probe (CHEBI:139246) |
| NBD-N(Me)-DKK(Biotin)βA-OH (CHEBI:139247) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| N-methyl-N-(7-nitro-2,1,3-benzoxadiazol-4-yl)-L-α-aspartyl-L-lysyl-N6-[5-(2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanoyl]-L-lysyl-β-alanine |
| Synonym | Source |
|---|---|
| N-methyl-N-(7-nitro-2,1,3-benzoxadiazol-4-yl)-Asp-Lys-Lys(biotin)-βAla-OH | ChEBI |
| Citations |
|---|