EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H17NO4S |
| Net Charge | 0 |
| Average Mass | 391.448 |
| Monoisotopic Mass | 391.08783 |
| SMILES | O=C(O)c1ccccc1SCCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C22H17NO4S/c24-20-16-9-3-6-14-7-4-10-17(19(14)16)21(25)23(20)12-5-13-28-18-11-2-1-8-15(18)22(26)27/h1-4,6-11H,5,12-13H2,(H,26,27) |
| InChIKey | GMVZUCHUOYUMLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. G-protein-coupled receptor agonist An agonist that binds to and activates G-protein-coupled receptors |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GRI977143 (CHEBI:139224) has role apoptosis inhibitor (CHEBI:68494) |
| GRI977143 (CHEBI:139224) has role G-protein-coupled receptor agonist (CHEBI:70998) |
| GRI977143 (CHEBI:139224) is a aryl sulfide (CHEBI:35683) |
| GRI977143 (CHEBI:139224) is a benzoic acids (CHEBI:22723) |
| GRI977143 (CHEBI:139224) is a benzoisoquinoline (CHEBI:39200) |
| IUPAC Name |
|---|
| 2-{[3-(1,3-dioxo-1H-benzo[de]isoquinolin-2(3H)-yl)propyl]sulfanyl}benzoic acid |
| Synonyms | Source |
|---|---|
| 2-{[3-(1,3-dioxo-1H-benzo[de]isoquinolin-2(3H)-yl)propyl]thio}benzoic acid | IUPAC |
| GRI 977143 | ChEBI |
| GRI-977143 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26636248 | Reaxys |
| CAS:325850-81-5 | ChemIDplus |
| Citations |
|---|