EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O |
| Net Charge | 0 |
| Average Mass | 176.219 |
| Monoisotopic Mass | 176.09496 |
| SMILES | NCCc1cnc2cccc(O)c12 |
| InChI | InChI=1S/C10H12N2O/c11-5-4-7-6-12-8-2-1-3-9(13)10(7)8/h1-3,6,12-13H,4-5,11H2 |
| InChIKey | FKIRTWDHOWAQGX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxytryptamine (CHEBI:139217) is a hydroxyindoles (CHEBI:84729) |
| 4-hydroxytryptamine (CHEBI:139217) is a primary amino compound (CHEBI:50994) |
| 4-hydroxytryptamine (CHEBI:139217) is a tryptamines (CHEBI:27162) |
| 4-hydroxytryptamine (CHEBI:139217) is conjugate base of 4-hydroxytryptamine(1+) (CHEBI:139069) |
| Incoming Relation(s) |
| 4-hydroxytryptamine(1+) (CHEBI:139069) is conjugate acid of 4-hydroxytryptamine (CHEBI:139217) |
| IUPAC Name |
|---|
| 3-(2-aminoethyl)-1H-indol-4-ol |
| Synonym | Source |
|---|---|
| 3-(2-aminoethyl)-indol-4-ol | ChEBI |
| Citations |
|---|