EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)[C@@H](O)C[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-25(2)14-15-30(24(33)34)19(16-25)18-8-9-21-27(5)12-11-22(31)26(3,4)20(27)10-13-28(21,6)29(18,7)17-23(30)32/h8,19-23,31-32H,9-17H2,1-7H3,(H,33,34)/t19-,20-,21+,22-,23-,27-,28+,29+,30+/m0/s1 |
| InChIKey | YKOPWPOFWMYZJZ-FMMUPTMQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myrtillocactus cochal (ncbitaxon:867465) | - | Article (J. Am. Chem. Soc., 1955, 77, 3579) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cochalic acid (CHEBI:139215) has parent hydride oleanane (CHEBI:36481) |
| cochalic acid (CHEBI:139215) has role plant metabolite (CHEBI:76924) |
| cochalic acid (CHEBI:139215) is a hydroxy carboxylic acid (CHEBI:24669) |
| cochalic acid (CHEBI:139215) is a monocarboxylic acid (CHEBI:25384) |
| cochalic acid (CHEBI:139215) is a pentacyclic triterpenoid (CHEBI:25872) |
| cochalic acid (CHEBI:139215) is a secondary alcohol (CHEBI:35681) |
| cochalic acid (CHEBI:139215) is conjugate acid of cochalate (CHEBI:138946) |
| Incoming Relation(s) |
| cochalate (CHEBI:138946) is conjugate base of cochalic acid (CHEBI:139215) |
| IUPAC Name |
|---|
| 3β,16β-dihydroxyolean-12-en-28-oic acid |
| Synonyms | Source |
|---|---|
| (3β,16β)-3,16-dihydroxyolean-12-en-28-oic acid | IUPAC |
| Cochalsaeure | ChEBI |
| Citations |
|---|