EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H66O16 |
| Net Charge | 0 |
| Average Mass | 863.007 |
| Monoisotopic Mass | 862.43509 |
| SMILES | [H][C@@]12C/C(=C\C(=O)OC)[C@H](OC(=O)/C=C/C=C/CCC)[C@@](O)(O1)C(C)(C)/C=C/[C@H]1C/C(=C\C(=O)OC)C[C@@H](C[C@]3(O)O[C@H](C[C@@H](O)CC(=O)O[C@@H]([C@@H](C)O)C2)C[C@H](O)C3(C)C)O1 |
| InChI | InChI=1S/C45H66O16/c1-9-10-11-12-13-14-37(49)59-41-29(21-39(51)56-8)20-32-24-35(27(2)46)58-40(52)23-30(47)22-33-25-36(48)43(5,6)44(53,60-33)26-34-18-28(19-38(50)55-7)17-31(57-34)15-16-42(3,4)45(41,54)61-32/h11-16,19,21,27,30-36,41,46-48,53-54H,9-10,17-18,20,22-26H2,1-8H3/b12-11+,14-13+,16-15+,28-19+,29-21+/t27-,30-,31+,32+,33-,34+,35-,36+,41+,44+,45-/m1/s1 |
| InChIKey | LIPGUSBNMQRYNL-IZBIBDMISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bugula neritina (ncbitaxon:10212) | - | Article (J. Nat. Prod., 1983, v46, 528-531) |
| Roles Classification |
|---|
| Biological Roles: | protein kinase C agonist An agonist that selectively binds to and activates a protein kinase C receptor marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bryostatin 2 (CHEBI:139177) has role antineoplastic agent (CHEBI:35610) |
| bryostatin 2 (CHEBI:139177) has role marine metabolite (CHEBI:76507) |
| bryostatin 2 (CHEBI:139177) has role protein kinase C agonist (CHEBI:64018) |
| bryostatin 2 (CHEBI:139177) is a bryostatins (CHEBI:3200) |
| bryostatin 2 (CHEBI:139177) is a cyclic hemiketal (CHEBI:59780) |
| bryostatin 2 (CHEBI:139177) is a enoate ester (CHEBI:51702) |
| bryostatin 2 (CHEBI:139177) is a methyl ester (CHEBI:25248) |
| bryostatin 2 (CHEBI:139177) is a organic heterotetracyclic compound (CHEBI:38163) |
| bryostatin 2 (CHEBI:139177) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,3S,5Z,7R,8E,11S,12S,13E,15S,17R,21R,23R,25S)-1,11,21,25-tetrahydroxy-17-[(1R)-1-hydroxyethyl]-5,13-bis(2-methoxy-2-oxoethylidene)-10,10,26,26-tetramethyl-19-oxo-18,27,28,29-tetraoxatetracyclo[21.3.1.13,7.111,15]nonacos-8-en-12-yl (2E,4E)-octa-2,4-dienoate |
| Synonyms | Source |
|---|---|
| 7-O-deacetylbryostatin 1 | ChemIDplus |
| (+)-bryostatin 2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| EP0496160 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8306043 | Reaxys |
| CAS:87745-28-6 | ChemIDplus |
| Citations |
|---|