EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N6O12P2S |
| Net Charge | -3 |
| Average Mass | 593.384 |
| Monoisotopic Mass | 593.02734 |
| SMILES | Cc1nc(C(=O)[O-])sc1CCOP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H22N6O12P2S/c1-7-9(38-15(22-7)17(26)27)2-3-32-36(28,29)35-37(30,31)33-4-8-11(24)12(25)16(34-8)23-6-21-10-13(18)19-5-20-14(10)23/h5-6,8,11-12,16,24-25H,2-4H2,1H3,(H,26,27)(H,28,29)(H,30,31)(H2,18,19,20)/p-3/t8-,11-,12-,16-/m1/s1 |
| InChIKey | VGXBGQACJQRWLV-LKGUXBDMSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ADP-5-ethyl-4-methylthiazole-2-carboxylate(3−) (CHEBI:139151) has functional parent ADP(3−) (CHEBI:456216) |
| ADP-5-ethyl-4-methylthiazole-2-carboxylate(3−) (CHEBI:139151) is a monocarboxylic acid anion (CHEBI:35757) |
| ADP-5-ethyl-4-methylthiazole-2-carboxylate(3−) (CHEBI:139151) is a organophosphate oxoanion (CHEBI:58945) |
| ADP-5-ethyl-4-methylthiazole-2-carboxylate(3−) (CHEBI:139151) is conjugate base of ADP-5-ethyl-4-methylthiazole-2-carboxylic acid (CHEBI:134399) |
| Incoming Relation(s) |
| ADP-5-ethyl-4-methylthiazole-2-carboxylic acid (CHEBI:134399) is conjugate acid of ADP-5-ethyl-4-methylthiazole-2-carboxylate(3−) (CHEBI:139151) |
| UniProt Name | Source |
|---|---|
| ADP-5-ethyl-4-methylthiazole-2-carboxylate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPDQT-400 | MetaCyc |
| Citations |
|---|