EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H45NO7S |
| Net Charge | 0 |
| Average Mass | 515.713 |
| Monoisotopic Mass | 515.29167 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=O)NCCS(=O)(=O)O)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@@H](O)C[C@@]3([H])[C@H](O)[C@@H](O)[C@@]21[H] |
| InChI | InChI=1S/C26H45NO7S/c1-15(4-7-21(29)27-12-13-35(32,33)34)17-5-6-18-22-19(9-11-25(17,18)2)26(3)10-8-16(28)14-20(26)23(30)24(22)31/h15-20,22-24,28,30-31H,4-14H2,1-3H3,(H,27,29)(H,32,33,34)/t15-,16-,17-,18+,19+,20+,22+,23+,24+,25-,26-/m1/s1 |
| InChIKey | XSOLDPYUICCHJX-QQXJNSDFSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tauro-α-muricholic acid (CHEBI:139136) is a 3α-hydroxy steroid (CHEBI:36835) |
| tauro-α-muricholic acid (CHEBI:139136) is a 6β-hydroxy steroid (CHEBI:36851) |
| tauro-α-muricholic acid (CHEBI:139136) is a 7α-hydroxy steroid (CHEBI:36843) |
| tauro-α-muricholic acid (CHEBI:139136) is a bile acid taurine conjugate (CHEBI:23219) |
| tauro-α-muricholic acid (CHEBI:139136) is conjugate acid of tauro-α-muricholate(1−) (CHEBI:172400) |
| Incoming Relation(s) |
| tauro-α-muricholate(1−) (CHEBI:172400) is conjugate base of tauro-α-muricholic acid (CHEBI:139136) |