EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H25N3O6S2 |
| Net Charge | 0 |
| Average Mass | 563.657 |
| Monoisotopic Mass | 563.11848 |
| SMILES | COc1ccccc1[C@@H](NS(=O)(=O)c1ccc2nc(=O)ccc2c1)C(=O)N(Cc1ccco1)Cc1cccs1 |
| InChI | InChI=1S/C28H25N3O6S2/c1-36-25-9-3-2-8-23(25)27(28(33)31(17-20-6-4-14-37-20)18-21-7-5-15-38-21)30-39(34,35)22-11-12-24-19(16-22)10-13-26(32)29-24/h2-16,27,30H,17-18H2,1H3,(H,29,32)/t27-/m1/s1 |
| InChIKey | IYIGLWQQAMROOF-HHHXNRCGSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.4.1.255 (protein O-GlcNAc transferase) inhibitor An EC 2.4.1.* (hexosyltransferase) inhibitor that interferes with the action of protein O-GlcNAc transferase (EC 2.4.1.255). EC 2.* (transferase) inhibitor An enzyme inhibitor that inhibits the action of a transferase (EC 2.*) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| OSMI-1 (CHEBI:139128) has role EC 2.* (transferase) inhibitor (CHEBI:71300) |
| OSMI-1 (CHEBI:139128) has role EC 2.4.1.255 (protein O-GlcNAc transferase) inhibitor (CHEBI:139153) |
| OSMI-1 (CHEBI:139128) is a aromatic ether (CHEBI:35618) |
| OSMI-1 (CHEBI:139128) is a furans (CHEBI:24129) |
| OSMI-1 (CHEBI:139128) is a quinolines (CHEBI:26513) |
| OSMI-1 (CHEBI:139128) is a sulfonamide (CHEBI:35358) |
| OSMI-1 (CHEBI:139128) is a tertiary carboxamide (CHEBI:140326) |
| OSMI-1 (CHEBI:139128) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| (2R)-N-(2-furylmethyl)-2-(2-methoxyphenyl)-2-{[(2-oxo-1,2-dihydroquinolin-6-yl)sulfonyl]amino}-N-(2-thienylmethyl)acetamide |
| Synonym | Source |
|---|---|
| (R)-N-(furan-2-ylmethyl)-2-(2-methoxyphenyl)-2-(2-oxo-1,2-dihydroquinoline-6-sulfonamido)-N-(thiophen-2-ylmethyl)acetamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29204918 | Reaxys |
| CAS:1681056-61-0 | SUBMITTER |
| Citations |
|---|