EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO2 |
| Net Charge | 0 |
| Average Mass | 193.246 |
| Monoisotopic Mass | 193.11028 |
| SMILES | CNC(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H15NO2/c1-8(12-2)5-9-3-4-10-11(6-9)14-7-13-10/h3-4,6,8,12H,5,7H2,1-2H3 |
| InChIKey | SHXWCVYOXRDMCX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | neurotoxin A poison that interferes with the functions of the nervous system. |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-methylenedioxymethamphetamine (CHEBI:1391) has role neurotoxin (CHEBI:50910) |
| 3,4-methylenedioxymethamphetamine (CHEBI:1391) is a amphetamines (CHEBI:35338) |
| 3,4-methylenedioxymethamphetamine (CHEBI:1391) is a benzodioxoles (CHEBI:38298) |
| IUPAC Name |
|---|
| 1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine |
| Synonyms | Source |
|---|---|
| 1-(1,3-Benzodioxol-5-yl)-N-methyl-2-propanamine | NIST Chemistry WebBook |
| 3,4-Methylenedioxymethamphetamine | KEGG COMPOUND |
| DL-(3,4-Methylenedioxy)methamphetamine | ChemIDplus |
| ecstasy | ChEBI |
| MDMA | ChemIDplus |
| MDMA | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07577 | KEGG COMPOUND |
| DB01454 | DrugBank |
| HMDB0041931 | HMDB |
| MDMA | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:158675 | Reaxys |
| CAS:42542-10-9 | KEGG COMPOUND |
| CAS:42542-10-9 | ChemIDplus |
| Citations |
|---|