EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14F2N2 |
| Net Charge | 0 |
| Average Mass | 284.309 |
| Monoisotopic Mass | 284.11250 |
| SMILES | [H][C@@]12C=CC[C@]1([H])[C@@H](c1cccnc1)Nc1c(F)cc(F)cc12 |
| InChI | InChI=1S/C17H14F2N2/c18-11-7-14-12-4-1-5-13(12)16(10-3-2-6-20-9-10)21-17(14)15(19)8-11/h1-4,6-9,12-13,16,21H,5H2/t12-,13+,16-/m1/s1 |
| InChIKey | NJZHEQOUHLZCOX-DVOMOZLQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3aS,4S,9bR)-golgicide A (CHEBI:139081) is a 6,8-difluoro-4-(pyridin-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (CHEBI:139076) |
| (3aS,4S,9bR)-golgicide A (CHEBI:139081) is enantiomer of (3aR,4R,9bS)-golgicide A (CHEBI:139080) |
| Incoming Relation(s) |
| trans-golgicide A (CHEBI:139082) has part (3aS,4S,9bR)-golgicide A (CHEBI:139081) |
| (3aR,4R,9bS)-golgicide A (CHEBI:139080) is enantiomer of (3aS,4S,9bR)-golgicide A (CHEBI:139081) |
| IUPAC Name |
|---|
| (3aS,4S,9bR)-6,8-difluoro-4-(pyridin-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| Synonym | Source |
|---|---|
| GCA-4 | ChEBI |