EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14F2N2 |
| Net Charge | 0 |
| Average Mass | 284.309 |
| Monoisotopic Mass | 284.11250 |
| SMILES | [H][C@@]12CC=C[C@]1([H])c1cc(F)cc(F)c1N[C@@H]2c1cccnc1 |
| InChI | InChI=1S/C17H14F2N2/c18-11-7-14-12-4-1-5-13(12)16(10-3-2-6-20-9-10)21-17(14)15(19)8-11/h1-4,6-9,12-13,16,21H,5H2/t12-,13+,16+/m0/s1 |
| InChIKey | NJZHEQOUHLZCOX-WOSRLPQWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3aR,4S,9bS)-golgicide A (CHEBI:139077) is a 6,8-difluoro-4-(pyridin-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (CHEBI:139076) |
| (3aR,4S,9bS)-golgicide A (CHEBI:139077) is enantiomer of (3aS,4R,9bR)-golgicide A (CHEBI:139078) |
| Incoming Relation(s) |
| cis-golgicide A (CHEBI:139079) has part (3aR,4S,9bS)-golgicide A (CHEBI:139077) |
| (3aS,4R,9bR)-golgicide A (CHEBI:139078) is enantiomer of (3aR,4S,9bS)-golgicide A (CHEBI:139077) |
| IUPAC Name |
|---|
| (3aR,4S,9bS)-6,8-difluoro-4-(pyridin-3-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| Synonym | Source |
|---|---|
| GCA-1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22795823 | Reaxys |