EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H26 |
| Net Charge | 0 |
| Average Mass | 170.340 |
| Monoisotopic Mass | 170.20345 |
| SMILES | CCC(CCCC(C)C)C(C)C |
| InChI | InChI=1S/C12H26/c1-6-12(11(4)5)9-7-8-10(2)3/h10-12H,6-9H2,1-5H3 |
| InChIKey | XEMFRSYZKNPRTA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | urine (BTO:0001419) | PubMed (12571373) |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-ethyl-2,7-dimethyloctane (CHEBI:139062) has role mouse metabolite (CHEBI:75771) |
| 3-ethyl-2,7-dimethyloctane (CHEBI:139062) has role pheromone (CHEBI:26013) |
| 3-ethyl-2,7-dimethyloctane (CHEBI:139062) is a alkane (CHEBI:18310) |
| 3-ethyl-2,7-dimethyloctane (CHEBI:139062) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| 3-ethyl-2,7-dimethyloctane |
| Synonym | Source |
|---|---|
| 3-ethyl-2,7-dimethyl octane | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 467989 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:62183-55-5 | NIST Chemistry WebBook |
| Citations |
|---|