EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O7P2 |
| Net Charge | -3 |
| Average Mass | 447.425 |
| Monoisotopic Mass | 447.17180 |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C\CC/C(C)=C\COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C20H36O7P2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-26-29(24,25)27-28(21,22)23/h9,11,13,15H,6-8,10,12,14,16H2,1-5H3,(H,24,25)(H2,21,22,23)/p-3/b18-11-,19-13-,20-15- |
| InChIKey | OINNEUNVOZHBOX-XBQSVVNOSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nerylneryl diphosphate(3−) (CHEBI:139032) is a organophosphate oxoanion (CHEBI:58945) |
| nerylneryl diphosphate(3−) (CHEBI:139032) is conjugate base of nerylneryl diphosphate (CHEBI:139478) |
| Incoming Relation(s) |
| nerylneryl diphosphate (CHEBI:139478) is conjugate acid of nerylneryl diphosphate(3−) (CHEBI:139032) |
| Synonyms | Source |
|---|---|
| (2Z,6Z,10Z)-tetraprenyl diphosphate(3−) | ChEBI |
| nerylneryl pyrophosphate(3−) | ChEBI |
| UniProt Name | Source |
|---|---|
| nerylneryl diphosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20218 | MetaCyc |
| Citations |
|---|