EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O4 |
| Net Charge | 0 |
| Average Mass | 444.656 |
| Monoisotopic Mass | 444.32396 |
| SMILES | [H][C@]1([C@@H](C)[C@@]2([H])CC[C@@]3([H])/C(=C/C=C4/C[C@@H](O)C[C@@H](O)C4=C)CCC[C@@]32C)CC[C@@]([H])(C(C)(C)O)O1 |
| InChI | InChI=1S/C28H44O4/c1-17-20(15-21(29)16-24(17)30)9-8-19-7-6-14-28(5)22(10-11-23(19)28)18(2)25-12-13-26(32-25)27(3,4)31/h8-9,18,21-26,29-31H,1,6-7,10-16H2,2-5H3/b19-8+,20-9-/t18-,21+,22+,23-,24+,25+,26-,28+/m0/s1 |
| InChIKey | DDIWZQGTNVZJGO-AOWJSLKNSA-N |
| Roles Classification |
|---|
| Biological Roles: | vitamin D receptor agonist An agonist that binds to and activates vitamin D receptors fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,3R)-dihydroxy-(20S)-[(5'S)-(2"-hydroxy-2"-propyl)-(2'R)-tetrahydrofuryl]-22,23,24,25,26,27-hexanor-1α-hydroxyvitamin D3 (CHEBI:139028) has role vitamin D receptor agonist (CHEBI:139503) |
| (1S,3R)-dihydroxy-(20S)-[(5'S)-(2"-hydroxy-2"-propyl)-(2'R)-tetrahydrofuryl]-22,23,24,25,26,27-hexanor-1α-hydroxyvitamin D3 (CHEBI:139028) is a D3 vitamins (CHEBI:73558) |
| (1S,3R)-dihydroxy-(20S)-[(5'S)-(2"-hydroxy-2"-propyl)-(2'R)-tetrahydrofuryl]-22,23,24,25,26,27-hexanor-1α-hydroxyvitamin D3 (CHEBI:139028) is a hydroxycalciol (CHEBI:47042) |
| (1S,3R)-dihydroxy-(20S)-[(5'S)-(2"-hydroxy-2"-propyl)-(2'R)-tetrahydrofuryl]-22,23,24,25,26,27-hexanor-1α-hydroxyvitamin D3 (CHEBI:139028) is a oxolanes (CHEBI:26912) |
| IUPAC Name |
|---|
| (1R,3R,5Z,7E,9ξ,20S)-20-[(2R,5S)-5-(2-hydroxypropan-2-yl)oxolan-2-yl]-9,10-secopregna-5,7,10-triene-1,3-diol |
| Citations |
|---|