EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O4 |
| Net Charge | 0 |
| Average Mass | 444.656 |
| Monoisotopic Mass | 444.32396 |
| SMILES | [H][C@]1([C@]2(C)C[C@H](CC(C)(C)O)CO2)CC[C@@]2([H])/C(=C/C=C3/C[C@@H](O)C[C@H](O)C3=C)CCC[C@]12C |
| InChI | InChI=1S/C28H44O4/c1-18-21(13-22(29)14-24(18)30)9-8-20-7-6-12-27(4)23(20)10-11-25(27)28(5)16-19(17-32-28)15-26(2,3)31/h8-9,19,22-25,29-31H,1,6-7,10-17H2,2-5H3/b20-8+,21-9-/t19-,22+,23-,24-,25-,27-,28-/m0/s1 |
| InChIKey | QFEREDUWILIRPI-VCQGKADLSA-N |
| Roles Classification |
|---|
| Biological Role: | agonist Substance which binds to cell receptors normally responding to naturally occurring substances and which produces a response of its own. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AMCR277A (CHEBI:139026) has functional parent calcitriol (CHEBI:17823) |
| AMCR277A (CHEBI:139026) has role agonist (CHEBI:48705) |
| AMCR277A (CHEBI:139026) is a hydroxycalciol (CHEBI:47042) |
| AMCR277A (CHEBI:139026) is a oxolanes (CHEBI:26912) |
| IUPAC Name |
|---|
| (1S,3R,5Z,7E,23S)-23-(2-hydroxy-2-methylpropyl)-20,24-epoxy-9,10-secochola-5,7,10-triene-1,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12849620 | Reaxys |
| Citations |
|---|