EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O2 |
| Net Charge | 0 |
| Average Mass | 440.712 |
| Monoisotopic Mass | 440.36543 |
| SMILES | [H][C@@]12CC=C3C(C)(C)[C@@H](O)CC[C@@]3([H])[C@]1(C)C(=O)C[C@@]1(C)[C@@]2(C)CC[C@]1([H])[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C30H48O2/c1-19(2)10-9-11-20(3)21-16-17-28(6)24-14-12-22-23(13-15-25(31)27(22,4)5)30(24,8)26(32)18-29(21,28)7/h10,12,20-21,23-25,31H,9,11,13-18H2,1-8H3/t20-,21-,23-,24+,25+,28+,29-,30+/m1/s1 |
| InChIKey | GBFPAYOKITZRAZ-XALYZVBKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Siraitia grosvenorii (ncbitaxon:190515) | - | PubMed (26903528) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-oxocucurbitadienol (CHEBI:138973) has functional parent cucurbitadienol (CHEBI:62456) |
| 11-oxocucurbitadienol (CHEBI:138973) has parent hydride cucurbitane (CHEBI:73245) |
| 11-oxocucurbitadienol (CHEBI:138973) has role plant metabolite (CHEBI:76924) |
| 11-oxocucurbitadienol (CHEBI:138973) is a cyclic terpene ketone (CHEBI:36130) |
| 11-oxocucurbitadienol (CHEBI:138973) is a secondary alcohol (CHEBI:35681) |
| 11-oxocucurbitadienol (CHEBI:138973) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (1S,4R)-1-hydroxy-99β,10,14-trimethyl-4,9-cyclo-9,10-secocholesta-5,24-dien-11-one |
| Synonyms | Source |
|---|---|
| 3β-hydroxy-10α-cucurbit-5,24-dien-11-one | ChEBI |
| (1S,4R,9β)-1-hydroxy-9,10,14-trimethyl-4,9-cyclo-9,10-secocholesta-5,24-dien-11-one | IUPAC |
| UniProt Name | Source |
|---|---|
| 11-oxocucurbitadienol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20418 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6745644 | Reaxys |
| Citations |
|---|