EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@@]12CC=C(CO)[C@H](CO)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C15H26O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h5,12-13,16-17H,4,6-10H2,1-3H3/t12-,13-,15+/m0/s1 |
| InChIKey | KUTDAKOPPDXZDV-KCQAQPDRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Drimys winteri (ncbitaxon:3419) | bark (BTO:0001301) | Article (Industrial crops and products. 2009, 30, 119-125) |
| Roles Classification |
|---|
| Biological Roles: | quorum sensing inhibitor Any compound that interferes with bacterial communication (quorum sensing, QS). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| drimendiol (CHEBI:138971) has functional parent drimenol (CHEBI:61148) |
| drimendiol (CHEBI:138971) has parent hydride drimane (CHEBI:36474) |
| drimendiol (CHEBI:138971) has role plant metabolite (CHEBI:76924) |
| drimendiol (CHEBI:138971) has role quorum sensing inhibitor (CHEBI:138977) |
| drimendiol (CHEBI:138971) is a allylic alcohol (CHEBI:134361) |
| drimendiol (CHEBI:138971) is a homoallylic alcohol (CHEBI:134362) |
| drimendiol (CHEBI:138971) is a octahydronaphthalenes (CHEBI:138397) |
| drimendiol (CHEBI:138971) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| [(1R,4aS,8aS)-5,5,8a-trimethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalene-1,2-diyl]dimethanol |
| Synonyms | Source |
|---|---|
| (−)-11,12-dihydroxy-7-drimene | ChEBI |
| (1R,4aS,8aS)-1,4,4a,5,6,7,8,8a-octahydro-1,2-bis(hydroxymethyl)-5,5,8a-trimethylnaphthalene | ChEBI |
| (−)-(5S,10S)-(9R)-7-drimene-11,12-diol | ChEBI |
| 5α,9β-drim-7-en-11,12-diol | ChEBI |
| (−)-drim-7-ene-11,12-diol | ChEBI |
| UniProt Name | Source |
|---|---|
| (5S,10S)-(9R)-7-drimene-11,12-diol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20471 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2416372 | Reaxys |
| Citations |
|---|