EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O |
| Net Charge | 0 |
| Average Mass | 286.459 |
| Monoisotopic Mass | 286.22967 |
| SMILES | [H][C@@]12CC=C(C=C)[C@@H](C)[C@@]1([H])CC[C@]1([H])C(C)(C)CC(=O)C[C@@]21C |
| InChI | InChI=1S/C20H30O/c1-6-14-7-9-17-16(13(14)2)8-10-18-19(3,4)11-15(21)12-20(17,18)5/h6-7,13,16-18H,1,8-12H2,2-5H3/t13-,16-,17-,18-,20+/m1/s1 |
| InChIKey | UAILOMMIENLFJQ-HSJLDRMUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | - | PubMed (25758958) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-cassa-12,15-dien-2-one (CHEBI:138969) has parent hydride ent-cassa-12,15-diene (CHEBI:50060) |
| ent-cassa-12,15-dien-2-one (CHEBI:138969) has role plant metabolite (CHEBI:76924) |
| ent-cassa-12,15-dien-2-one (CHEBI:138969) is a cyclic terpene ketone (CHEBI:36130) |
| ent-cassa-12,15-dien-2-one (CHEBI:138969) is a diterpenoid (CHEBI:23849) |
| IUPAC Name |
|---|
| (5β,8α,9β,10α,14β)-13-ethenyl-14-methylpodocarp-12-en-2-one |
| Synonyms | Source |
|---|---|
| 2-oxo-ent-cassa-12,15-diene | ChEBI |
| 2-keto-ent-cassa-12,15-diene | ChEBI |
| UniProt Name | Source |
|---|---|
| ent-cassa-12,15-dien-2-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20324 | MetaCyc |
| Citations |
|---|