EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@@]12CC=C(C=C)[C@@H](C)[C@@]1([H])CC[C@]1([H])C(C)(C)[C@H](O)[C@H](O)C[C@@]21C |
| InChI | InChI=1S/C20H32O2/c1-6-13-7-9-15-14(12(13)2)8-10-17-19(3,4)18(22)16(21)11-20(15,17)5/h6-7,12,14-18,21-22H,1,8-11H2,2-5H3/t12-,14-,15-,16-,17-,18-,20+/m1/s1 |
| InChIKey | FMPZXFBEGPUMKF-HUIUSYGUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | - | PubMed (25758958) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-cassa-12,15-dien-2β,3β-diol (CHEBI:138968) has parent hydride ent-cassa-12,15-diene (CHEBI:50060) |
| ent-cassa-12,15-dien-2β,3β-diol (CHEBI:138968) has role plant metabolite (CHEBI:76924) |
| ent-cassa-12,15-dien-2β,3β-diol (CHEBI:138968) is a diol (CHEBI:23824) |
| ent-cassa-12,15-dien-2β,3β-diol (CHEBI:138968) is a diterpenoid (CHEBI:23849) |
| ent-cassa-12,15-dien-2β,3β-diol (CHEBI:138968) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2α,3α,5β,8α,9β,10α,14β)-13-ethenyl-14-methylpodocarp-12-ene-2,3-diol |
| UniProt Name | Source |
|---|---|
| ent-cassa-12,15-dien-2β,3β-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20413 | MetaCyc |
| Citations |
|---|