EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O |
| Net Charge | 0 |
| Average Mass | 288.475 |
| Monoisotopic Mass | 288.24532 |
| SMILES | [H][C@@]12CC=C3C[C@](C)(C=C)CC[C@@]3([H])[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C20H32O/c1-6-19(4)11-9-15-14(13-19)7-8-16-18(2,3)17(21)10-12-20(15,16)5/h6-7,15-17,21H,1,8-13H2,2-5H3/t15-,16+,17+,19-,20-/m1/s1 |
| InChIKey | BLRQCWSOICYRPH-HDHSKVTNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | - | PubMed (25758958) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9β-pimara-7,15-diene-3β-ol (CHEBI:138966) has parent hydride 9β-pimara-7,15-diene (CHEBI:50067) |
| 9β-pimara-7,15-diene-3β-ol (CHEBI:138966) has role plant metabolite (CHEBI:76924) |
| 9β-pimara-7,15-diene-3β-ol (CHEBI:138966) is a pimarane diterpenoid (CHEBI:49192) |
| 9β-pimara-7,15-diene-3β-ol (CHEBI:138966) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 9β-pimara-7,15-diene-3β-ol |
| Synonym | Source |
|---|---|
| (3β,9β)-pimara-7,15-dien-3-ol | IUPAC |
| UniProt Name | Source |
|---|---|
| 9β-pimara-7,15-diene-3β-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20321 | MetaCyc |
| Citations |
|---|