EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)C[C@@H](O)[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O2/c1-25(2)13-14-27(5)15-16-29(7)19(20(27)17-25)9-10-22-28(6)12-11-23(32)26(3,4)24(28)21(31)18-30(22,29)8/h9,20-24,31-32H,10-18H2,1-8H3/t20-,21+,22+,23-,24-,27+,28+,29+,30+/m0/s1 |
| InChIKey | JYNBNJRQZZSLPN-NYVWVNPOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Datura inoxia (ncbitaxon:4075) | seed (BTO:0001226) | PubMed (4745874) | |
| Datura metel (ncbitaxon:35625) | - | Article (Khaleque et al., Sci Res (Dacca), 1966, 3, 212) | |
| Datura stramonium (ncbitaxon:4076) | seed (BTO:0001226) | PubMed (22568232) | |
| Vernicia fordii (ncbitaxon:73154) | leaf (BTO:0000713) | PubMed (23727783) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daturadiol (CHEBI:138955) has parent hydride oleanane (CHEBI:36481) |
| daturadiol (CHEBI:138955) has role plant metabolite (CHEBI:76924) |
| daturadiol (CHEBI:138955) is a diol (CHEBI:23824) |
| daturadiol (CHEBI:138955) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| olean-12-ene-3β,6β-diol |
| Synonym | Source |
|---|---|
| (3β,6β)-olean-12-ene-3,6-diol | IUPAC |
| UniProt Name | Source |
|---|---|
| daturadiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20244 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3168747 | Reaxys |
| CAS:41498-79-7 | ChemIDplus |
| Citations |
|---|