EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O11P2 |
| Net Charge | 0 |
| Average Mass | 310.088 |
| Monoisotopic Mass | 309.98548 |
| SMILES | O=C(COP(=O)(O)O)[C@@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C5H12O11P2/c6-3(1-15-17(9,10)11)5(8)4(7)2-16-18(12,13)14/h3,5-6,8H,1-2H2,(H2,9,10,11)(H2,12,13,14)/t3-,5+/m1/s1 |
| InChIKey | YAHZABJORDUQGO-WUJLRWPWSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 4.1.1.39 (ribulose-bisphosphate carboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of ribulose-bisphosphate carboxylase (EC 4.1.1.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-xylulose 1,5-bisphosphate (CHEBI:138937) has functional parent D-xylulose (CHEBI:17140) |
| D-xylulose 1,5-bisphosphate (CHEBI:138937) has role EC 4.1.1.39 (ribulose-bisphosphate carboxylase) inhibitor (CHEBI:138938) |
| D-xylulose 1,5-bisphosphate (CHEBI:138937) is a xylulose phosphate (CHEBI:27355) |
| D-xylulose 1,5-bisphosphate (CHEBI:138937) is conjugate acid of D-xylulose 1,5-bisphosphate(4−) (CHEBI:138268) |
| Incoming Relation(s) |
| D-xylulose 1,5-bisphosphate(4−) (CHEBI:138268) is conjugate base of D-xylulose 1,5-bisphosphate (CHEBI:138937) |
| IUPAC Name |
|---|
| 1,5-di-O-phosphono-D-xylulose |
| Synonyms | Source |
|---|---|
| Xylulose 1,5-bisphosphate | ChemIDplus |
| D-threo-2-Pentulose | ChemIDplus |
| D-xylulose 1,5-bis(dihydrogen phosphate) | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:31278065 | Reaxys |
| CAS:15565-46-5 | ChemIDplus |
| Citations |
|---|