EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6N2O3S |
| Net Charge | 0 |
| Average Mass | 150.159 |
| Monoisotopic Mass | 150.00991 |
| SMILES | N[C@@H](CSN=O)C(=O)O |
| InChI | InChI=1S/C3H6N2O3S/c4-2(3(6)7)1-9-5-8/h2H,1,4H2,(H,6,7)/t2-/m0/s1 |
| InChIKey | XOWVFANEOZMPKG-REOHCLBHSA-N |
| Roles Classification |
|---|
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. vasodilator agent A drug used to cause dilation of the blood vessels. hematologic agent Drug that acts on blood and blood-forming organs and those that affect the hemostatic system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-nitroso-L-cysteine (CHEBI:138935) has role hematologic agent (CHEBI:50248) |
| S-nitroso-L-cysteine (CHEBI:138935) has role platelet aggregation inhibitor (CHEBI:50427) |
| S-nitroso-L-cysteine (CHEBI:138935) has role vasodilator agent (CHEBI:35620) |
| S-nitroso-L-cysteine (CHEBI:138935) is a L-cysteine derivative (CHEBI:83824) |
| S-nitroso-L-cysteine (CHEBI:138935) is a nitrosothio compound (CHEBI:145545) |
| Incoming Relation(s) |
| S-nitroso-L-cysteine residue (CHEBI:149494) is substituent group from S-nitroso-L-cysteine (CHEBI:138935) |
| Synonyms | Source |
|---|---|
| CysNO | ChEBI |
| S-nitroso-L-cysteine | PDBeChem |
| L-CysSNO | ChEBI |
| Nitrosocysteine | ChemIDplus |
| NO-cysteine | ChEBI |
| NO-L-cysteine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| SNC | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3538115 | Reaxys |
| CAS:51209-75-7 | ChemIDplus |
| Citations |
|---|