EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56O2 |
| Net Charge | 0 |
| Average Mass | 568.886 |
| Monoisotopic Mass | 568.42803 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C[C@H](O)CC2(C)C)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-24,35-36,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36+ |
| InChIKey | JKQXZKUSFCKOGQ-YOPUJPICSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25752849) | |
| Oncorhynchus mykiss (ncbitaxon:8022) | - | PubMed (27721557) | |
| Salmo Trutta (ncbitaxon:8032) | - | PubMed (27721557) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meso-zeaxanthin (CHEBI:138919) has parent hydride β-carotene (CHEBI:17579) |
| meso-zeaxanthin (CHEBI:138919) has role anti-inflammatory agent (CHEBI:67079) |
| meso-zeaxanthin (CHEBI:138919) has role antioxidant (CHEBI:22586) |
| meso-zeaxanthin (CHEBI:138919) has role human xenobiotic metabolite (CHEBI:76967) |
| meso-zeaxanthin (CHEBI:138919) has role marine metabolite (CHEBI:76507) |
| meso-zeaxanthin (CHEBI:138919) is a carotenol (CHEBI:23045) |
| IUPAC Names |
|---|
| (3R,3'S)-dihydroxy-β,β-carotene |
| (3R,3'S)-β,β-carotene-3,3'-diol |
| Synonyms | Source |
|---|---|
| 3'-epi-zeaxanthin | ChEBI |
| (R,S)-Zeaxanthin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (3R,3'S)-zeaxanthin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00023218 | KNApSAcK |
| Meso-zeaxanthin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2230335 | Reaxys |
| CAS:31272-50-1 | ChemIDplus |
| Citations |
|---|