EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N2O4S |
| Net Charge | 0 |
| Average Mass | 274.342 |
| Monoisotopic Mass | 274.09873 |
| SMILES | CC(O)C1C(=O)N2C1CC(SCCN)C2C(=O)O |
| InChI | InChI=1S/C11H18N2O4S/c1-5(14)8-6-4-7(18-3-2-12)9(11(16)17)13(6)10(8)15/h5-9,14H,2-4,12H2,1H3,(H,16,17) |
| InChIKey | DMEPNWQBJCSHJH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-Dihydrothienamycin (CHEBI:138873) is a carbapenems (CHEBI:46633) |
| Manual Xrefs | Databases |
|---|---|
| C20820 | KEGG COMPOUND |