EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O7S2 |
| Net Charge | 0 |
| Average Mass | 352.390 |
| Monoisotopic Mass | 352.03989 |
| SMILES | [H][C@@]1([C@H](C)OS(=O)(=O)O)C(=O)N2C(C(=O)O)=C(SCCN)C[C@@]21[H] |
| InChI | InChI=1S/C11H16N2O7S2/c1-5(20-22(17,18)19)8-6-4-7(21-3-2-12)9(11(15)16)13(6)10(8)14/h5-6,8H,2-4,12H2,1H3,(H,15,16)(H,17,18,19)/t5-,6+,8-/m0/s1 |
| InChIKey | DQNRXGXUXNFASL-BBVRLYRLSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Deacetylepithienamycin F (CHEBI:138872) is a carbapenems (CHEBI:46633) |
| Synonyms | Source |
|---|---|
| Deacetyl MM 17880 | KEGG COMPOUND |
| NA 26975 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C20816 | KEGG COMPOUND |