EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N5 |
| Net Charge | 0 |
| Average Mass | 349.482 |
| Monoisotopic Mass | 349.22665 |
| SMILES | NCCCCN(Cc1nc2ccccc2n1)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C21H27N5/c22-12-3-4-14-26(15-20-24-17-9-1-2-10-18(17)25-20)19-11-5-7-16-8-6-13-23-21(16)19/h1-2,6,8-10,13,19H,3-5,7,11-12,14-15,22H2,(H,24,25)/t19-/m0/s1 |
| InChIKey | WVLHHLRVNDMIAR-IBGZPJMESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AMD 070 (CHEBI:138865) has role anti-HIV agent (CHEBI:64946) |
| AMD 070 (CHEBI:138865) has role antineoplastic agent (CHEBI:35610) |
| AMD 070 (CHEBI:138865) is a aminoquinoline (CHEBI:36709) |
| Synonyms | Source |
|---|---|
| Amd 070 | ChEMBL |
| AMD-070 | ChEMBL |
| AMD070 | ChEMBL |
| AMD-11070 | ChEMBL |
| AMD11070 | ChEMBL |
| Cxcr4 inhibitor x4p-001 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C20266 | KEGG COMPOUND |
| Citations |
|---|