EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:138856 - oxolinic acid
| Formula | C13H11NO5 |
| Net Charge | 0 |
| Average Mass | 261.233 |
| Monoisotopic Mass | 261.06372 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C13H11NO5/c1-2-14-5-8(13(16)17)12(15)7-3-10-11(4-9(7)14)19-6-18-10/h3-5H,2,6H2,1H3,(H,16,17) |
| InChIKey | KYGZCKSPAKDVKC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. enzyme inhibitor A compound or agent that combines with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxolinic acid (CHEBI:138856) has role antibacterial drug (CHEBI:36047) |
| oxolinic acid (CHEBI:138856) has role antifungal agent (CHEBI:35718) |
| oxolinic acid (CHEBI:138856) has role antiinfective agent (CHEBI:35441) |
| oxolinic acid (CHEBI:138856) has role antimicrobial agent (CHEBI:33281) |
| oxolinic acid (CHEBI:138856) has role enzyme inhibitor (CHEBI:23924) |
| oxolinic acid (CHEBI:138856) is a aromatic carboxylic acid (CHEBI:33859) |
| oxolinic acid (CHEBI:138856) is a organic heterotricyclic compound (CHEBI:26979) |
| oxolinic acid (CHEBI:138856) is a oxacycle (CHEBI:38104) |
| oxolinic acid (CHEBI:138856) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| oxolinic acid (CHEBI:138856) is a quinolone antibiotic (CHEBI:86324) |
| oxolinic acid (CHEBI:138856) is conjugate acid of oxolinate (CHEBI:59066) |
| Incoming Relation(s) |
| oxolinate (CHEBI:59066) is conjugate base of oxolinic acid (CHEBI:138856) |
| IUPAC Name |
|---|
| 5-ethyl-8-oxo-5,8-dihydro[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| INNs | Source |
|---|---|
| acide oxolinique | ChemIDplus |
| ácido oxolínico | WHO MedNet |
| acidum oxolinicum | ChemIDplus |
| oxolinic acid | KEGG DRUG |
| oxolinic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-Ethyl-1,4-dihydro-6,7-methylenedioxy-4-oxo-3-quinolinecarboxylic acid | ChemIDplus |
| 1-Ethyl-6,7-methylenedioxy-4-quinolone-3-carboxylic acid | ChemIDplus |
| 5-Ethyl-5,8-dihydro-8-oxo-1,3-dioxolo(4,5-g)quinoline-7-carboxylic acid | ChemIDplus |
| OA | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2609419 | Gmelin |
| Reaxys:620635 | Reaxys |
| CAS:14698-29-4 | KEGG COMPOUND |
| CAS:14698-29-4 | ChemIDplus |
| Citations |
|---|