EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11NO5 |
| Net Charge | 0 |
| Average Mass | 261.233 |
| Monoisotopic Mass | 261.06372 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C13H11NO5/c1-2-14-5-8(13(16)17)12(15)7-3-10-11(4-9(7)14)19-6-18-10/h3-5H,2,6H2,1H3,(H,16,17) |
| InChIKey | KYGZCKSPAKDVKC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. enzyme inhibitor A compound or agent that combines with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxolinic acid (CHEBI:138856) has role antibacterial drug (CHEBI:36047) |
| oxolinic acid (CHEBI:138856) has role antifungal agent (CHEBI:35718) |
| oxolinic acid (CHEBI:138856) has role antiinfective agent (CHEBI:35441) |
| oxolinic acid (CHEBI:138856) has role antimicrobial agent (CHEBI:33281) |
| oxolinic acid (CHEBI:138856) has role enzyme inhibitor (CHEBI:23924) |
| oxolinic acid (CHEBI:138856) is a aromatic carboxylic acid (CHEBI:33859) |
| oxolinic acid (CHEBI:138856) is a organic heterotricyclic compound (CHEBI:26979) |
| oxolinic acid (CHEBI:138856) is a oxacycle (CHEBI:38104) |
| oxolinic acid (CHEBI:138856) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| oxolinic acid (CHEBI:138856) is a quinolone antibiotic (CHEBI:86324) |
| oxolinic acid (CHEBI:138856) is conjugate acid of oxolinate (CHEBI:59066) |
| Incoming Relation(s) |
| oxolinate (CHEBI:59066) is conjugate base of oxolinic acid (CHEBI:138856) |
| IUPAC Name |
|---|
| 5-ethyl-8-oxo-5,8-dihydro[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| INNs | Source |
|---|---|
| oxolinic acid | KEGG DRUG |
| acide oxolinique | ChemIDplus |
| ácido oxolínico | WHO MedNet |
| acidum oxolinicum | ChemIDplus |
| oxolinic acid | WHO MedNet |
| Synonyms | Source |
|---|---|
| OA | KEGG DRUG |
| 1-Ethyl-1,4-dihydro-6,7-methylenedioxy-4-oxo-3-quinolinecarboxylic acid | ChemIDplus |
| 1-Ethyl-6,7-methylenedioxy-4-quinolone-3-carboxylic acid | ChemIDplus |
| 5-Ethyl-5,8-dihydro-8-oxo-1,3-dioxolo(4,5-g)quinoline-7-carboxylic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2609419 | Gmelin |
| Reaxys:620635 | Reaxys |
| CAS:14698-29-4 | KEGG COMPOUND |
| CAS:14698-29-4 | ChemIDplus |
| Citations |
|---|