EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O2 |
| Net Charge | 0 |
| Average Mass | 250.382 |
| Monoisotopic Mass | 250.19328 |
| SMILES | CC(=O)OC(C)/C(C)=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C16H26O2/c1-11-8-7-9-16(5,6)15(11)10-12(2)13(3)18-14(4)17/h8,10,13,15H,7,9H2,1-6H3/b12-10+ |
| InChIKey | TYUPZTIJMKMYHL-ZRDIBKRKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis (ncbitaxon:3701) | - | PubMed (27883040) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24903350) | Identified in normal mammary cells and breast cancer cells. |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-isomethylionyl acetate (CHEBI:138772) has role flavouring agent (CHEBI:35617) |
| α-isomethylionyl acetate (CHEBI:138772) has role human metabolite (CHEBI:77746) |
| α-isomethylionyl acetate (CHEBI:138772) has role plant metabolite (CHEBI:76924) |
| α-isomethylionyl acetate (CHEBI:138772) is a acetate ester (CHEBI:47622) |
| α-isomethylionyl acetate (CHEBI:138772) is a olefinic compound (CHEBI:78840) |
| α-isomethylionyl acetate (CHEBI:138772) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (3E)-3-methyl-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-yl acetate |
| Synonyms | Source |
|---|---|
| 1,2-dimethyl-3-(2,6,6-trimethyl-2-cyclohexen-1-yl)propen-1-yl acetate | ChemIDplus |
| (3E)-3-methyl-4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-3-buten-2-yl acetate | ChEBI |
| 3-methyl-4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-3-buten-2-ol acetate | ChemIDplus |
| 3-methyl-4-(2,6,6-trimethylcyclohex-2-enyl)but-3-en-2-yl acetate | ChEBI |
| 3-methyl-α-ionyl acetate | HMDB |
| alpha-isomethylionyl acetate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4942023 | ChemSpider |
| FDB016747 | FooDB |
| HMDB0037631 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:68555-61-3 | ChemIDplus |
| Citations |
|---|