EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O4 |
| Net Charge | 0 |
| Average Mass | 254.286 |
| Monoisotopic Mass | 254.12666 |
| SMILES | Cc1cc(=O)c(O)cn1CCCCC(N)C(=O)O |
| InChI | InChI=1S/C12H18N2O4/c1-8-6-10(15)11(16)7-14(8)5-3-2-4-9(13)12(17)18/h6-7,9,16H,2-5,13H2,1H3,(H,17,18) |
| InChIKey | HNGPZFLHRXCYGZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-pyridosine (CHEBI:138764) is a α-amino acid (CHEBI:33704) |
| Manual Xrefs | Databases |
|---|---|
| 14749748 | ChemSpider |
| HMDB0029443 | HMDB |