EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H22BrNO4S |
| Net Charge | 0 |
| Average Mass | 536.447 |
| Monoisotopic Mass | 535.04529 |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NC(=O)/C=C/c1ccccc1Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H22BrNO4S/c1-33-25-14-13-24(28)18-26(25)34(31,32)29-27(30)15-12-21-7-3-5-9-23(21)17-19-10-11-20-6-2-4-8-22(20)16-19/h2-16,18H,17H2,1H3,(H,29,30)/b15-12+ |
| InChIKey | ODTKFNUPVBULRJ-NTCAYCPXSA-N |
| Roles Classification |
|---|
| Biological Role: | prostaglandin receptor antagonist An antagonist that binds to and blocks the activity of prostaglandin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-798106 (CHEBI:138743) has role prostaglandin receptor antagonist (CHEBI:138887) |
| L-798106 (CHEBI:138743) is a N-sulfonylcarboxamide (CHEBI:90852) |
| L-798106 (CHEBI:138743) is a aromatic ether (CHEBI:35618) |
| L-798106 (CHEBI:138743) is a bromobenzenes (CHEBI:37149) |
| IUPAC Name |
|---|
| (2E)-N-[(5-bromo-2-methoxyphenyl)sulfonyl]-3-[2-(naphthalen-2-ylmethyl)phenyl]prop-2-enamide |
| Synonym | Source |
|---|---|
| (2E)-N-[(5-bromo-2-methoxyphenyl)sulfonyl]-3-[2-(2-naphthalenylmethyl)phenyl]-2-propenamide | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8946912 | Reaxys |
| CAS:244101-02-8 | SUBMITTER |
| Citations |
|---|