EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:138742 - cholesteryl hemisuccinate
| Formula | C31H50O4 |
| Net Charge | 0 |
| Average Mass | 486.737 |
| Monoisotopic Mass | 486.37091 |
| SMILES | [H][C@@]12CC=C3C[C@@H](OC(=O)CCC(=O)O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C31H50O4/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(35-29(34)14-13-28(32)33)15-17-30(22,4)27(24)16-18-31(25,26)5/h9,20-21,23-27H,6-8,10-19H2,1-5H3,(H,32,33)/t21-,23+,24+,25-,26+,27+,30+,31-/m1/s1 |
| InChIKey | WLNARFZDISHUGS-MIXBDBMTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | detergent A surfactant (or a mixture containing one or more surfactants) having cleaning properties in dilute solutions. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | detergent A surfactant (or a mixture containing one or more surfactants) having cleaning properties in dilute solutions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cholesteryl hemisuccinate (CHEBI:138742) has functional parent cholesterol (CHEBI:16113) |
| cholesteryl hemisuccinate (CHEBI:138742) has role detergent (CHEBI:27780) |
| cholesteryl hemisuccinate (CHEBI:138742) is a cholestane ester (CHEBI:131696) |
| cholesteryl hemisuccinate (CHEBI:138742) is a dicarboxylic acid monoester (CHEBI:36244) |
| cholesteryl hemisuccinate (CHEBI:138742) is a hemisuccinate (CHEBI:138979) |
| IUPAC Name |
|---|
| 4-[(3β)-cholest-5-en-3-yloxy]-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 3β-hydroxy-5-cholestene 3-hemisuccinate | SUBMITTER |
| 4-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid | SUBMITTER |
| cholest-5-en-3β-yl hydrogen succinate | ChemIDplus |
| cholesteryl succinate | ChemIDplus |
| Citations |
|---|