EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14F3NO2 |
| Net Charge | 0 |
| Average Mass | 333.309 |
| Monoisotopic Mass | 333.09766 |
| SMILES | CNC1=C(c2cccc(C(F)(F)F)c2)C(=O)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C18H14F3NO2/c1-22-17-14(12-8-5-9-13(10-12)18(19,20)21)15(23)16(24-17)11-6-3-2-4-7-11/h2-10,16,22H,1H3/t16-/m1/s1 |
| InChIKey | NYRMIJKDBAQCHC-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-flurtamone (CHEBI:138739) is a 5-(methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3(2H)-one (CHEBI:138738) |
| (R)-flurtamone (CHEBI:138739) is enantiomer of (S)-flurtamone (CHEBI:138740) |
| Incoming Relation(s) |
| flurtamone (CHEBI:138737) has part (R)-flurtamone (CHEBI:138739) |
| (S)-flurtamone (CHEBI:138740) is enantiomer of (R)-flurtamone (CHEBI:138739) |
| IUPAC Name |
|---|
| (2R)-5-(methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3(2H)-one |