EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H56O2 |
| Net Charge | 0 |
| Average Mass | 424.754 |
| Monoisotopic Mass | 424.42803 |
| SMILES | CCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCC |
| InChI | InChI=1S/C28H56O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-30-28(29)26-24-22-20-18-16-14-12-10-8-6-4-2/h3-27H2,1-2H3 |
| InChIKey | DZKXJUASMGQEMA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euglena gracilis (ncbitaxon:3039) | - | PubMed (25860691) |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetradecyl tetradecanoate (CHEBI:138721) has functional parent tetradecan-1-ol (CHEBI:77417) |
| tetradecyl tetradecanoate (CHEBI:138721) has role algal metabolite (CHEBI:84735) |
| tetradecyl tetradecanoate (CHEBI:138721) is a tetradecanoate ester (CHEBI:87691) |
| tetradecyl tetradecanoate (CHEBI:138721) is a wax ester (CHEBI:10036) |
| IUPAC Name |
|---|
| tetradecyl tetradecanoate |
| Synonyms | Source |
|---|---|
| 14:0-14:0Alc | ChEBI |
| myristyl myristate | ChemIDplus |
| myristyl tetradecanoate | NIST Chemistry WebBook |
| tetradecyl myristate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Ceraphyl 424 | NIST Chemistry WebBook |
| Cetiol MM | NIST Chemistry WebBook |
| Crodamol MM | NIST Chemistry WebBook |
| Cyclochem MM | NIST Chemistry WebBook |
| Liponate MM | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| tetradecyl tetradecanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMFA07010035 | LIPID MAPS |
| Citations |
|---|