EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O4 |
| Net Charge | 0 |
| Average Mass | 170.164 |
| Monoisotopic Mass | 170.05791 |
| SMILES | OCC(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H10O4/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8-12H,4H2 |
| InChIKey | MTVWFVDWRVYDOR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydroxyphenylethyleneglycol (CHEBI:1387) has role metabolite (CHEBI:25212) |
| 3,4-dihydroxyphenylethyleneglycol (CHEBI:1387) has role mouse metabolite (CHEBI:75771) |
| 3,4-dihydroxyphenylethyleneglycol (CHEBI:1387) is a catechols (CHEBI:33566) |
| 3,4-dihydroxyphenylethyleneglycol (CHEBI:1387) is a tetrol (CHEBI:33573) |
| Incoming Relation(s) |
| (R)-3,4-dihydroxyphenylethyleneglycol (CHEBI:182967) is a 3,4-dihydroxyphenylethyleneglycol (CHEBI:1387) |
| IUPAC Name |
|---|
| 4-(1,2-dihydroxyethyl)benzene-1,2-diol |
| Synonyms | Source |
|---|---|
| 1-(3,4-dihydroxyphenyl)-1,2-ethanediol | ChEBI |
| 2-hydroxy-2-(3,4-dihydroxy)phenylethanol | ChEBI |
| 3,4-dihydroxyphenethyl glycol | ChEBI |
| (3,4-dihydroxyphenyl)ethylene glycol | ChEBI |
| 3,4-dihydroxyphenylethyl glycol | ChEBI |
| 3,4-Dihydroxyphenylglycol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 3,4-dihydroxyphenylethyleneglycol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05576 | KEGG COMPOUND |
| CPD-11878 | MetaCyc |
| HMDB0000318 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2210995 | Reaxys |
| CAS:3343-19-9 | ChemIDplus |
| Citations |
|---|