EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19NO19S3 |
| Net Charge | 0 |
| Average Mass | 577.473 |
| Monoisotopic Mass | 576.97134 |
| SMILES | O=C(O)C1=C[C@H](O)[C@@H](OS(=O)(=O)O)[C@H](O[C@H]2[C@H](O)[C@@H](NS(=O)(=O)O)[C@@H](O)O[C@@H]2COS(=O)(=O)O)O1 |
| InChI | InChI=1S/C12H19NO19S3/c14-3-1-4(10(16)17)30-12(8(3)32-35(25,26)27)31-9-5(2-28-34(22,23)24)29-11(18)6(7(9)15)13-33(19,20)21/h1,3,5-9,11-15,18H,2H2,(H,16,17)(H,19,20,21)(H,22,23,24)(H,25,26,27)/t3-,5+,6+,7+,8+,9+,11-,12-/m0/s1 |
| InChIKey | LRPGJWKAYQRIAQ-GYBHJADLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sus scrofa (ncbitaxon:9823) | - | PubMed (20729345) | Porcine intestinal mucosa heparin |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HP_dp02_0009 (CHEBI:138683) is a monocarboxylic acid (CHEBI:25384) |
| HP_dp02_0009 (CHEBI:138683) is a oligosaccharide sulfate (CHEBI:37909) |
| HP_dp02_0009 (CHEBI:138683) is a unsaturated heparin disaccharide (CHEBI:138728) |
| HP_dp02_0009 (CHEBI:138683) is conjugate acid of heparin disaccharide I-S(4−) (CHEBI:43053) |
| Incoming Relation(s) |
| heparin disaccharide I-S(4−) (CHEBI:43053) is conjugate base of HP_dp02_0009 (CHEBI:138683) |
| IUPAC Name |
|---|
| 2-deoxy-4-O-(4-deoxy-2-O-sulfo-α-L-threo-hex-4-enopyranuronosyl)-6-O-sulfo-2-(sulfoamino)-α-D-glucopyranose |
| Synonyms | Source |
|---|---|
| alpha-delta4,5-UA(2S)-(1-4)-alpha-D-GlcpNS(6S) | IUPAC |
| H1S | ChEBI |
| α-Δ4,5-UA(2S)-(1-4)-α-D-GlcpNS(6S) | ChEBI |
| heparin disaccharide I-S | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| G01871HO | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1419414 | Reaxys |
| Citations |
|---|