EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14Cl2F2N4OS |
| Net Charge | 0 |
| Average Mass | 431.295 |
| Monoisotopic Mass | 430.02334 |
| SMILES | CC(C)C(=O)Nc1ncc(-c2cc(C(F)F)nn2-c2c(Cl)cccc2Cl)s1 |
| InChI | InChI=1S/C17H14Cl2F2N4OS/c1-8(2)16(26)23-17-22-7-13(27-17)12-6-11(15(20)21)24-25(12)14-9(18)4-3-5-10(14)19/h3-8,15H,1-2H3,(H,22,23,26) |
| InChIKey | IVUGBSGLHRJSSP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | LIM kinase inhibitor An that interferes with the activity of any of the actin-binding kinases that phosphorylate members of the ADF/cofilin family of actin binding and filament severing proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LimKi 3 (CHEBI:138670) has role LIM kinase inhibitor (CHEBI:139074) |
| LimKi 3 (CHEBI:138670) is a 1,3-thiazoles (CHEBI:38418) |
| LimKi 3 (CHEBI:138670) is a dichlorobenzene (CHEBI:23697) |
| LimKi 3 (CHEBI:138670) is a organofluorine compound (CHEBI:37143) |
| LimKi 3 (CHEBI:138670) is a pyrazoles (CHEBI:26410) |
| LimKi 3 (CHEBI:138670) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-{5-[1-(2,6-dichlorophenyl)-3-(difluoromethyl)-1H-pyrazol-5-yl]-1,3-thiazol-2-yl}-2-methylpropanamide |
| Synonyms | Source |
|---|---|
| BMS3 | ChEBI |
| N-(5-(1-(2,6-dichlorophenyl)-3-(difluoromethyl)-1H-pyrazol-5-yl)thiazol-2-yl)isobutyramide | SUBMITTER |
| LIM Kinase Inhibitor I | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24178549 | Reaxys |
| CAS:1338247-35-0 | SUBMITTER |
| Citations |
|---|