EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O7 |
| Net Charge | 0 |
| Average Mass | 256.210 |
| Monoisotopic Mass | 256.05830 |
| SMILES | O=C(O)C(O)C(O)(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C11H12O7/c12-7-3-1-6(2-4-7)5-11(18,10(16)17)8(13)9(14)15/h1-4,8,12-13,18H,5H2,(H,14,15)(H,16,17) |
| InChIKey | TUODPMGCCJSJRH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piscidic acid (CHEBI:138667) is a benzenes (CHEBI:22712) |
| piscidic acid (CHEBI:138667) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2,3-dihydroxy-2-[(4-hydroxyphenyl)methyl]butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 107741 | ChemSpider |
| HMDB0030809 | HMDB |